C13H18N4O2 — CID 156767783
(2S)-2-amino-3-[4-(4-ethoxyphenyl)triazol-1-yl]propan-1-ol (PubChem CID 156767783) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(4-ethoxyphenyl)triazol-1-yl]propan-1-ol.
| Compound Name | (2S)-2-amino-3-[4-(4-ethoxyphenyl)triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 156767783 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (2S)-2-amino-3-[4-(4-ethoxyphenyl)triazol-1-yl]propan-1-ol |
| SMILES | CCOc1ccc(-c2cn(C[C@H](N)CO)nn2)cc1 |
| InChI | InChI=1S/C13H18N4O2/c1-2-19-12-5-3-10(4-6-12)13-8-17(16-15-13)7-11(14)9-18/h3-6,8,11,18H,2,7,9,14H2,1H3/t11-/m0/s1 |
| InChIKey | XLDQTQKLRYGHFI-NSHDSACASA-N |
| XLogP | 0.66 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |