C18H26N4O4 — CID 89437341
methyl 3-[4-[5-(diethoxymethyl)-2-pyridinyl]triazol-1-yl]-2,2-dimethylpropanoate (PubChem CID 89437341) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl 3-[4-[5-(diethoxymethyl)-2-pyridinyl]triazol-1-yl]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[4-[5-(diethoxymethyl)-2-pyridinyl]triazol-1-yl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 89437341 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | methyl 3-[4-[5-(diethoxymethyl)-2-pyridinyl]triazol-1-yl]-2,2-dimethylpropanoate |
| SMILES | CCOC(OCC)c1ccc(-c2cn(CC(C)(C)C(=O)OC)nn2)nc1 |
| InChI | InChI=1S/C18H26N4O4/c1-6-25-16(26-7-2)13-8-9-14(19-10-13)15-11-22(21-20-15)12-18(3,4)17(23)24-5/h8-11,16H,6-7,12H2,1-5H3 |
| InChIKey | KQOPYPBICZSQBL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|