C9H15N3O2 — CID 58459637
methyl 1-(2,2-dimethylpropyl)triazole-4-carboxylate (PubChem CID 58459637) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is methyl 1-(2,2-dimethylpropyl)triazole-4-carboxylate.
| Compound Name | methyl 1-(2,2-dimethylpropyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 58459637 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | methyl 1-(2,2-dimethylpropyl)triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CC(C)(C)C)nn1 |
| InChI | InChI=1S/C9H15N3O2/c1-9(2,3)6-12-5-7(10-11-12)8(13)14-4/h5H,6H2,1-4H3 |
| InChIKey | GGCQSUNLBZVKNY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |