C8H12N4O3 — CID 103107579
methyl 1-[3-(methylamino)-3-oxopropyl]triazole-4-carboxylate (PubChem CID 103107579) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is methyl 1-[3-(methylamino)-3-oxopropyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[3-(methylamino)-3-oxopropyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103107579 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | methyl 1-[3-(methylamino)-3-oxopropyl]triazole-4-carboxylate |
| SMILES | CNC(=O)CCn1cc(C(=O)OC)nn1 |
| InChI | InChI=1S/C8H12N4O3/c1-9-7(13)3-4-12-5-6(10-11-12)8(14)15-2/h5H,3-4H2,1-2H3,(H,9,13) |
| InChIKey | KNLWKMGXAQMEDA-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |