C9H14N4O3 — CID 103642831
methyl 1-[2-oxo-2-(propylamino)ethyl]triazole-4-carboxylate (PubChem CID 103642831) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is methyl 1-[2-oxo-2-(propylamino)ethyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[2-oxo-2-(propylamino)ethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103642831 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | methyl 1-[2-oxo-2-(propylamino)ethyl]triazole-4-carboxylate |
| SMILES | CCCNC(=O)Cn1cc(C(=O)OC)nn1 |
| InChI | InChI=1S/C9H14N4O3/c1-3-4-10-8(14)6-13-5-7(11-12-13)9(15)16-2/h5H,3-4,6H2,1-2H3,(H,10,14) |
| InChIKey | FXEOSNJYOFICQO-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |