C12H19N5O4 — CID 103107669
methyl 1-[2-(3-methylbutylcarbamoylamino)-2-oxoethyl]triazole-4-carboxylate (PubChem CID 103107669) has the molecular formula C12H19N5O4 and a molecular weight of 297.31 g/mol. Its IUPAC name is methyl 1-[2-(3-methylbutylcarbamoylamino)-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[2-(3-methylbutylcarbamoylamino)-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103107669 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | methyl 1-[2-(3-methylbutylcarbamoylamino)-2-oxoethyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)NC(=O)NCCC(C)C)nn1 |
| InChI | InChI=1S/C12H19N5O4/c1-8(2)4-5-13-12(20)14-10(18)7-17-6-9(15-16-17)11(19)21-3/h6,8H,4-5,7H2,1-3H3,(H2,13,14,18,20) |
| InChIKey | MDNCERIAECQXFI-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |