C10H17N5O4 — CID 81444598
2-[4-(1-hydroxyethyl)triazol-1-yl]-N-(2-methoxyethylcarbamoyl)acetamide (PubChem CID 81444598) has the molecular formula C10H17N5O4 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[4-(1-hydroxyethyl)triazol-1-yl]-N-(2-methoxyethylcarbamoyl)acetamide.
| Compound Name | 2-[4-(1-hydroxyethyl)triazol-1-yl]-N-(2-methoxyethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 81444598 |
| Molecular Formula | C10H17N5O4 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-[4-(1-hydroxyethyl)triazol-1-yl]-N-(2-methoxyethylcarbamoyl)acetamide |
| SMILES | COCCNC(=O)NC(=O)Cn1cc(C(C)O)nn1 |
| InChI | InChI=1S/C10H17N5O4/c1-7(16)8-5-15(14-13-8)6-9(17)12-10(18)11-3-4-19-2/h5,7,16H,3-4,6H2,1-2H3,(H2,11,12,17,18) |
| InChIKey | BFMMUNMIIGRBQT-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|