C8H12N4O4 — CID 81443796
methyl N-[2-[4-(1-hydroxyethyl)triazol-1-yl]acetyl]carbamate (PubChem CID 81443796) has the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. Its IUPAC name is methyl N-[2-[4-(1-hydroxyethyl)triazol-1-yl]acetyl]carbamate.
| Compound Name | methyl N-[2-[4-(1-hydroxyethyl)triazol-1-yl]acetyl]carbamate |
|---|---|
| PubChem CID | 81443796 |
| Molecular Formula | C8H12N4O4 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | methyl N-[2-[4-(1-hydroxyethyl)triazol-1-yl]acetyl]carbamate |
| SMILES | COC(=O)NC(=O)Cn1cc(C(C)O)nn1 |
| InChI | InChI=1S/C8H12N4O4/c1-5(13)6-3-12(11-10-6)4-7(14)9-8(15)16-2/h3,5,13H,4H2,1-2H3,(H,9,14,15) |
| InChIKey | NOIJEHBGQPRXDM-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |