C9H15N5O3 — CID 106221194
methyl N-[2-[4-(3-aminopropyl)triazol-1-yl]acetyl]carbamate (PubChem CID 106221194) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl N-[2-[4-(3-aminopropyl)triazol-1-yl]acetyl]carbamate.
| Compound Name | methyl N-[2-[4-(3-aminopropyl)triazol-1-yl]acetyl]carbamate |
|---|---|
| PubChem CID | 106221194 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | methyl N-[2-[4-(3-aminopropyl)triazol-1-yl]acetyl]carbamate |
| SMILES | COC(=O)NC(=O)Cn1cc(CCCN)nn1 |
| InChI | InChI=1S/C9H15N5O3/c1-17-9(16)11-8(15)6-14-5-7(12-13-14)3-2-4-10/h5H,2-4,6,10H2,1H3,(H,11,15,16) |
| InChIKey | GORSKBKTLCHPOH-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |