C10H19N5O — CID 106221459
2-[4-(3-aminopropyl)triazol-1-yl]-N-ethyl-N-methylacetamide (PubChem CID 106221459) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 2-[4-(3-aminopropyl)triazol-1-yl]-N-ethyl-N-methylacetamide.
| Compound Name | 2-[4-(3-aminopropyl)triazol-1-yl]-N-ethyl-N-methylacetamide |
|---|---|
| PubChem CID | 106221459 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 2-[4-(3-aminopropyl)triazol-1-yl]-N-ethyl-N-methylacetamide |
| SMILES | CCN(C)C(=O)Cn1cc(CCCN)nn1 |
| InChI | InChI=1S/C10H19N5O/c1-3-14(2)10(16)8-15-7-9(12-13-15)5-4-6-11/h7H,3-6,8,11H2,1-2H3 |
| InChIKey | MOTUVYHGDQFXQO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |