C9H17N5O — CID 62055542
2-[4-(aminomethyl)triazol-1-yl]-N,N-diethylacetamide (PubChem CID 62055542) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 62055542 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C9H17N5O/c1-3-13(4-2)9(15)7-14-6-8(5-10)11-12-14/h6H,3-5,7,10H2,1-2H3 |
| InChIKey | JWHVPBFTHWEPAS-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |