C13H24N6O2 — CID 116642302
2-[4-(2-aminoethyl)triazol-1-yl]-N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]acetamide (PubChem CID 116642302) has the molecular formula C13H24N6O2 and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)triazol-1-yl]-N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]acetamide.
| Compound Name | 2-[4-(2-aminoethyl)triazol-1-yl]-N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 116642302 |
| Molecular Formula | C13H24N6O2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-[4-(2-aminoethyl)triazol-1-yl]-N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]acetamide |
| SMILES | CCN(CC(=O)NC(C)C)C(=O)Cn1cc(CCN)nn1 |
| InChI | InChI=1S/C13H24N6O2/c1-4-18(8-12(20)15-10(2)3)13(21)9-19-7-11(5-6-14)16-17-19/h7,10H,4-6,8-9,14H2,1-3H3,(H,15,20) |
| InChIKey | JLUSDTLPFIEBDG-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |