C8H15N5O — CID 62053781
2-[4-(aminomethyl)triazol-1-yl]-N-ethyl-N-methylacetamide (PubChem CID 62053781) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-ethyl-N-methylacetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-ethyl-N-methylacetamide |
|---|---|
| PubChem CID | 62053781 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-ethyl-N-methylacetamide |
| SMILES | CCN(C)C(=O)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C8H15N5O/c1-3-12(2)8(14)6-13-5-7(4-9)10-11-13/h5H,3-4,6,9H2,1-2H3 |
| InChIKey | AHNRGPIIPAPSBF-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |