C13H26N6O2 — CID 115459440
2-[4-(aminomethyl)triazol-1-yl]-N-[3-(dimethylamino)propyl]-N-(2-methoxyethyl)acetamide (PubChem CID 115459440) has the molecular formula C13H26N6O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-[3-(dimethylamino)propyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-[3-(dimethylamino)propyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 115459440 |
| Molecular Formula | C13H26N6O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-[3-(dimethylamino)propyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCN(CCCN(C)C)C(=O)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C13H26N6O2/c1-17(2)5-4-6-18(7-8-21-3)13(20)11-19-10-12(9-14)15-16-19/h10H,4-9,11,14H2,1-3H3 |
| InChIKey | NIURBEJQGNNDCX-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |