C12H23N5O2 — CID 115459690
2-[4-(aminomethyl)triazol-1-yl]-N-butan-2-yl-N-(2-methoxyethyl)acetamide (PubChem CID 115459690) has the molecular formula C12H23N5O2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-butan-2-yl-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-butan-2-yl-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 115459690 |
| Molecular Formula | C12H23N5O2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-butan-2-yl-N-(2-methoxyethyl)acetamide |
| SMILES | CCC(C)N(CCOC)C(=O)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C12H23N5O2/c1-4-10(2)17(5-6-19-3)12(18)9-16-8-11(7-13)14-15-16/h8,10H,4-7,9,13H2,1-3H3 |
| InChIKey | BNRULGSUHKFCHV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |