2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate

C10H18N4O3 — CID 115458410

IUPAC2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate
SMILESCC(C)OCCOC(=O)Cn1cc(CN)nn1
InChIInChI=1S/C10H18N4O3/c1-8(2)16-3-4-17-10(15)7-14-6-9(5-11)12-13-14/h6,8H,3-5,7,11H2,1-2H3
InChIKeyGPCNOOCONVMJAJ-UHFFFAOYSA-N
MW242.28 g/mol
LogP-0.29
Rot. Bonds7

About 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate

2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate (PubChem CID 115458410) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate.

Molecular Properties

Compound Name2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate
PubChem CID115458410
Molecular FormulaC10H18N4O3
Molecular Weight242.28 g/mol
Exact Mass242.14
IUPAC Name2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate
SMILESCC(C)OCCOC(=O)Cn1cc(CN)nn1
InChIInChI=1S/C10H18N4O3/c1-8(2)16-3-4-17-10(15)7-14-6-9(5-11)12-13-14/h6,8H,3-5,7,11H2,1-2H3
InChIKeyGPCNOOCONVMJAJ-UHFFFAOYSA-N
XLogP-0.29
TPSA92.26 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.28
LogP ≤ 5-0.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate?
The IUPAC name of 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate (CID 115458410) is 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate.
What is the SMILES notation for 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate?
The canonical SMILES for 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate is CC(C)OCCOC(=O)Cn1cc(CN)nn1.
What is the InChIKey of 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate?
The InChIKey is GPCNOOCONVMJAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O3/c1-8(2)16-3-4-17-10(15)7-14-6-9(5-11)12-13-14/h6,8H,3-5,7,11H2,1-2H3.
What are the key properties of 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate?
2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate has a molecular weight of 242.28 g/mol, XLogP of -0.29, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate is sourced from PubChem (CID 115458410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).