C10H18N4O3 — CID 115458410
2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate (PubChem CID 115458410) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate.
| Compound Name | 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate |
|---|---|
| PubChem CID | 115458410 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 2-propan-2-yloxyethyl 2-[4-(aminomethyl)triazol-1-yl]acetate |
| SMILES | CC(C)OCCOC(=O)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C10H18N4O3/c1-8(2)16-3-4-17-10(15)7-14-6-9(5-11)12-13-14/h6,8H,3-5,7,11H2,1-2H3 |
| InChIKey | GPCNOOCONVMJAJ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|