C11H19N5O3 — CID 115459149
methyl (2S)-2-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-3-methylbutanoate (PubChem CID 115459149) has the molecular formula C11H19N5O3 and a molecular weight of 269.31 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 115459149 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | methyl (2S)-2-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)Cn1cc(CN)nn1)C(C)C |
| InChI | InChI=1S/C11H19N5O3/c1-7(2)10(11(18)19-3)13-9(17)6-16-5-8(4-12)14-15-16/h5,7,10H,4,6,12H2,1-3H3,(H,13,17)/t10-/m0/s1 |
| InChIKey | ZJBQTVHRRNVSSU-JTQLQIEISA-N |
| XLogP | -0.95 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |