C9H15N5O3 — CID 43422579
methyl 3-methyl-2-[[2-(tetrazol-1-yl)acetyl]amino]butanoate (PubChem CID 43422579) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl 3-methyl-2-[[2-(tetrazol-1-yl)acetyl]amino]butanoate.
| Compound Name | methyl 3-methyl-2-[[2-(tetrazol-1-yl)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 43422579 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | methyl 3-methyl-2-[[2-(tetrazol-1-yl)acetyl]amino]butanoate |
| SMILES | COC(=O)C(NC(=O)Cn1cnnn1)C(C)C |
| InChI | InChI=1S/C9H15N5O3/c1-6(2)8(9(16)17-3)11-7(15)4-14-5-10-12-13-14/h5-6,8H,4H2,1-3H3,(H,11,15) |
| InChIKey | AHKBJDRTCWAGNR-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |