C7H11N5O4 — CID 24711091
3-hydroxy-2-[[2-(tetrazol-1-yl)acetyl]amino]butanoic acid (PubChem CID 24711091) has the molecular formula C7H11N5O4 and a molecular weight of 229.20 g/mol. Its IUPAC name is 3-hydroxy-2-[[2-(tetrazol-1-yl)acetyl]amino]butanoic acid.
| Compound Name | 3-hydroxy-2-[[2-(tetrazol-1-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 24711091 |
| Molecular Formula | C7H11N5O4 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 3-hydroxy-2-[[2-(tetrazol-1-yl)acetyl]amino]butanoic acid |
| SMILES | CC(O)C(NC(=O)Cn1cnnn1)C(=O)O |
| InChI | InChI=1S/C7H11N5O4/c1-4(13)6(7(15)16)9-5(14)2-12-3-8-10-11-12/h3-4,6,13H,2H2,1H3,(H,9,14)(H,15,16) |
| InChIKey | KJZVZAVKELLQQQ-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |