C15H19N3O3 — CID 24800199
methyl (2S)-2-[(2-indazol-2-ylacetyl)amino]-3-methylbutanoate (PubChem CID 24800199) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl (2S)-2-[(2-indazol-2-ylacetyl)amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(2-indazol-2-ylacetyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 24800199 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | methyl (2S)-2-[(2-indazol-2-ylacetyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)Cn1cc2ccccc2n1)C(C)C |
| InChI | InChI=1S/C15H19N3O3/c1-10(2)14(15(20)21-3)16-13(19)9-18-8-11-6-4-5-7-12(11)17-18/h4-8,10,14H,9H2,1-3H3,(H,16,19)/t14-/m0/s1 |
| InChIKey | XZRMYEHNVSEICZ-AWEZNQCLSA-N |
| XLogP | 1.35 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |