C17H22N4O4 — CID 24800202
methyl (2S)-2-[[2-[(2-indazol-1-ylacetyl)amino]acetyl]amino]-3-methylbutanoate (PubChem CID 24800202) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[(2-indazol-1-ylacetyl)amino]acetyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[2-[(2-indazol-1-ylacetyl)amino]acetyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 24800202 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | methyl (2S)-2-[[2-[(2-indazol-1-ylacetyl)amino]acetyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)CNC(=O)Cn1ncc2ccccc21)C(C)C |
| InChI | InChI=1S/C17H22N4O4/c1-11(2)16(17(24)25-3)20-14(22)9-18-15(23)10-21-13-7-5-4-6-12(13)8-19-21/h4-8,11,16H,9-10H2,1-3H3,(H,18,23)(H,20,22)/t16-/m0/s1 |
| InChIKey | YTLDETJMGDRSNF-INIZCTEOSA-N |
| XLogP | 0.47 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |