C14H17N3O4 — CID 97260617
methyl (2R)-2-[(2-indazol-1-ylacetyl)amino]-3-methoxypropanoate (PubChem CID 97260617) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl (2R)-2-[(2-indazol-1-ylacetyl)amino]-3-methoxypropanoate.
| Compound Name | methyl (2R)-2-[(2-indazol-1-ylacetyl)amino]-3-methoxypropanoate |
|---|---|
| PubChem CID | 97260617 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | methyl (2R)-2-[(2-indazol-1-ylacetyl)amino]-3-methoxypropanoate |
| SMILES | COC[C@@H](NC(=O)Cn1ncc2ccccc21)C(=O)OC |
| InChI | InChI=1S/C14H17N3O4/c1-20-9-11(14(19)21-2)16-13(18)8-17-12-6-4-3-5-10(12)7-15-17/h3-7,11H,8-9H2,1-2H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | OJOCDYQPNIKKNU-LLVKDONJSA-N |
| XLogP | 0.34 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |