C20H19N5O — CID 95906024
2-indazol-1-yl-N-[(1S)-1-(3-pyrazol-1-ylphenyl)ethyl]acetamide (PubChem CID 95906024) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 2-indazol-1-yl-N-[(1S)-1-(3-pyrazol-1-ylphenyl)ethyl]acetamide.
| Compound Name | 2-indazol-1-yl-N-[(1S)-1-(3-pyrazol-1-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 95906024 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-indazol-1-yl-N-[(1S)-1-(3-pyrazol-1-ylphenyl)ethyl]acetamide |
| SMILES | C[C@H](NC(=O)Cn1ncc2ccccc21)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C20H19N5O/c1-15(16-7-4-8-18(12-16)24-11-5-10-21-24)23-20(26)14-25-19-9-3-2-6-17(19)13-22-25/h2-13,15H,14H2,1H3,(H,23,26)/t15-/m0/s1 |
| InChIKey | RYPXMNAFGKESIZ-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |