C14H17N3O3 — CID 119234556
5-[(2-indazol-1-ylacetyl)amino]pentanoic acid (PubChem CID 119234556) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 5-[(2-indazol-1-ylacetyl)amino]pentanoic acid.
| Compound Name | 5-[(2-indazol-1-ylacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119234556 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 5-[(2-indazol-1-ylacetyl)amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)Cn1ncc2ccccc21 |
| InChI | InChI=1S/C14H17N3O3/c18-13(15-8-4-3-7-14(19)20)10-17-12-6-2-1-5-11(12)9-16-17/h1-2,5-6,9H,3-4,7-8,10H2,(H,15,18)(H,19,20) |
| InChIKey | BARLUGKMYQNTEU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|