C13H15N3O3 — CID 110886182
N-(3-hydroxypropyl)-2-(1-oxophthalazin-2-yl)acetamide (PubChem CID 110886182) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2-(1-oxophthalazin-2-yl)acetamide.
| Compound Name | N-(3-hydroxypropyl)-2-(1-oxophthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 110886182 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(3-hydroxypropyl)-2-(1-oxophthalazin-2-yl)acetamide |
| SMILES | O=C(Cn1ncc2ccccc2c1=O)NCCCO |
| InChI | InChI=1S/C13H15N3O3/c17-7-3-6-14-12(18)9-16-13(19)11-5-2-1-4-10(11)8-15-16/h1-2,4-5,8,17H,3,6-7,9H2,(H,14,18) |
| InChIKey | CMXNDRNSARTKMM-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|