C20H18N4O2S — CID 46571757
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-(1-oxophthalazin-2-yl)acetamide (PubChem CID 46571757) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-(1-oxophthalazin-2-yl)acetamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-(1-oxophthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 46571757 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-(1-oxophthalazin-2-yl)acetamide |
| SMILES | N#Cc1ccccc1CSCCNC(=O)Cn1ncc2ccccc2c1=O |
| InChI | InChI=1S/C20H18N4O2S/c21-11-15-5-1-2-7-17(15)14-27-10-9-22-19(25)13-24-20(26)18-8-4-3-6-16(18)12-23-24/h1-8,12H,9-10,13-14H2,(H,22,25) |
| InChIKey | DPIROWAUEJAYGZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|