C10H15N5O5 — CID 103698319
methyl 1-[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]triazole-4-carboxylate (PubChem CID 103698319) has the molecular formula C10H15N5O5 and a molecular weight of 285.26 g/mol. Its IUPAC name is methyl 1-[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103698319 |
| Molecular Formula | C10H15N5O5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 1-[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]triazole-4-carboxylate |
| SMILES | COCCNC(=O)NC(=O)Cn1cc(C(=O)OC)nn1 |
| InChI | InChI=1S/C10H15N5O5/c1-19-4-3-11-10(18)12-8(16)6-15-5-7(13-14-15)9(17)20-2/h5H,3-4,6H2,1-2H3,(H2,11,12,16,18) |
| InChIKey | GUCREJIFYMFDNM-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|