C14H15N5O4 — CID 122241471
methyl 1-[2-(4-acetamidoanilino)-2-oxoethyl]triazole-4-carboxylate (PubChem CID 122241471) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is methyl 1-[2-(4-acetamidoanilino)-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[2-(4-acetamidoanilino)-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 122241471 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | methyl 1-[2-(4-acetamidoanilino)-2-oxoethyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)Nc2ccc(NC(C)=O)cc2)nn1 |
| InChI | InChI=1S/C14H15N5O4/c1-9(20)15-10-3-5-11(6-4-10)16-13(21)8-19-7-12(17-18-19)14(22)23-2/h3-7H,8H2,1-2H3,(H,15,20)(H,16,21) |
| InChIKey | NYZNHECXIHOQMF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |