C15H18N4O5 — CID 122241516
ethyl 1-[2-(3,4-dimethoxyanilino)-2-oxoethyl]triazole-4-carboxylate (PubChem CID 122241516) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is ethyl 1-[2-(3,4-dimethoxyanilino)-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | ethyl 1-[2-(3,4-dimethoxyanilino)-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 122241516 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | ethyl 1-[2-(3,4-dimethoxyanilino)-2-oxoethyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CC(=O)Nc2ccc(OC)c(OC)c2)nn1 |
| InChI | InChI=1S/C15H18N4O5/c1-4-24-15(21)11-8-19(18-17-11)9-14(20)16-10-5-6-12(22-2)13(7-10)23-3/h5-8H,4,9H2,1-3H3,(H,16,20) |
| InChIKey | GLXKXVMDAOZYIY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |