C15H19N5O5 — CID 112521547
ethyl N-[2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112521547) has the molecular formula C15H19N5O5 and a molecular weight of 349.35 g/mol. Its IUPAC name is ethyl N-[2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112521547 |
| Molecular Formula | C15H19N5O5 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | ethyl N-[2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cnn(CC(=O)Nc2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C15H19N5O5/c1-4-25-15(22)18-13-8-16-20(19-13)9-14(21)17-10-5-6-11(23-2)12(7-10)24-3/h5-8H,4,9H2,1-3H3,(H,17,21)(H,18,19,22) |
| InChIKey | KZKOUKFSHJMLPO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |