C7H11N5O3 — CID 112520587
ethyl N-[2-(2-amino-2-oxoethyl)triazol-4-yl]carbamate (PubChem CID 112520587) has the molecular formula C7H11N5O3 and a molecular weight of 213.20 g/mol. Its IUPAC name is ethyl N-[2-(2-amino-2-oxoethyl)triazol-4-yl]carbamate.
| Compound Name | ethyl N-[2-(2-amino-2-oxoethyl)triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112520587 |
| Molecular Formula | C7H11N5O3 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | ethyl N-[2-(2-amino-2-oxoethyl)triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cnn(CC(N)=O)n1 |
| InChI | InChI=1S/C7H11N5O3/c1-2-15-7(14)10-6-3-9-12(11-6)4-5(8)13/h3H,2,4H2,1H3,(H2,8,13)(H,10,11,14) |
| InChIKey | AVPJVNJERLUJJH-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |