C12H19N5O4 — CID 112520362
ethyl N-[2-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]triazol-4-yl]carbamate (PubChem CID 112520362) has the molecular formula C12H19N5O4 and a molecular weight of 297.32 g/mol. Its IUPAC name is ethyl N-[2-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[2-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112520362 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | ethyl N-[2-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cnn(CC(=O)NCC2CCCO2)n1 |
| InChI | InChI=1S/C12H19N5O4/c1-2-20-12(19)15-10-7-14-17(16-10)8-11(18)13-6-9-4-3-5-21-9/h7,9H,2-6,8H2,1H3,(H,13,18)(H,15,16,19) |
| InChIKey | LEPMSECIGSOZII-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |