C12H18IN3O2 — CID 7335205
2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 7335205) has the molecular formula C12H18IN3O2 and a molecular weight of 363.20 g/mol. Its IUPAC name is 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 7335205 |
| Molecular Formula | C12H18IN3O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | Cc1nn(CC(=O)NC[C@@H]2CCCO2)c(C)c1I |
| InChI | InChI=1S/C12H18IN3O2/c1-8-12(13)9(2)16(15-8)7-11(17)14-6-10-4-3-5-18-10/h10H,3-7H2,1-2H3,(H,14,17)/t10-/m0/s1 |
| InChIKey | XSPKBHFZIOSPER-JTQLQIEISA-N |
| XLogP | 1.40 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|