C12H15BrF3N3O2 — CID 2861623
2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 2861623) has the molecular formula C12H15BrF3N3O2 and a molecular weight of 370.17 g/mol. Its IUPAC name is 2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 2861623 |
| Molecular Formula | C12H15BrF3N3O2 |
| Molecular Weight | 370.17 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | Cc1c(Br)c(C(F)(F)F)nn1CC(=O)NCC1CCCO1 |
| InChI | InChI=1S/C12H15BrF3N3O2/c1-7-10(13)11(12(14,15)16)18-19(7)6-9(20)17-5-8-3-2-4-21-8/h8H,2-6H2,1H3,(H,17,20) |
| InChIKey | OXCCUTISGGTGJN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |