C13H21F3N2O2 — CID 163344737
N-(oxolan-2-ylmethyl)-2-[4-(trifluoromethyl)piperidin-1-yl]acetamide (PubChem CID 163344737) has the molecular formula C13H21F3N2O2 and a molecular weight of 294.32 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-[4-(trifluoromethyl)piperidin-1-yl]acetamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-[4-(trifluoromethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 163344737 |
| Molecular Formula | C13H21F3N2O2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-[4-(trifluoromethyl)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(C(F)(F)F)CC1)NCC1CCCO1 |
| InChI | InChI=1S/C13H21F3N2O2/c14-13(15,16)10-3-5-18(6-4-10)9-12(19)17-8-11-2-1-7-20-11/h10-11H,1-9H2,(H,17,19) |
| InChIKey | CYTQPOLYOMXZSJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |