C13H22N2O3 — CID 62655740
2-(4-formylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 62655740) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(4-formylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(4-formylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 62655740 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-(4-formylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=CC1CCN(CC(=O)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C13H22N2O3/c16-10-11-3-5-15(6-4-11)9-13(17)14-8-12-2-1-7-18-12/h10-12H,1-9H2,(H,14,17) |
| InChIKey | DFAMEVXBMTUKQG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|