C14H18N6O5S — CID 112521966
ethyl N-[2-[2-[[4-(aminomethyl)phenyl]sulfonylamino]-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112521966) has the molecular formula C14H18N6O5S and a molecular weight of 382.40 g/mol. Its IUPAC name is ethyl N-[2-[2-[[4-(aminomethyl)phenyl]sulfonylamino]-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[2-[2-[[4-(aminomethyl)phenyl]sulfonylamino]-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112521966 |
| Molecular Formula | C14H18N6O5S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | ethyl N-[2-[2-[[4-(aminomethyl)phenyl]sulfonylamino]-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cnn(CC(=O)NS(=O)(=O)c2ccc(CN)cc2)n1 |
| InChI | InChI=1S/C14H18N6O5S/c1-2-25-14(22)17-12-8-16-20(18-12)9-13(21)19-26(23,24)11-5-3-10(7-15)4-6-11/h3-6,8H,2,7,9,15H2,1H3,(H,19,21)(H,17,18,22) |
| InChIKey | MICQEHFFXNOCKF-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |