C15H16F3N5O4 — CID 112523331
ethyl N-[2-[2-[2-methoxy-5-(trifluoromethyl)anilino]-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112523331) has the molecular formula C15H16F3N5O4 and a molecular weight of 387.32 g/mol. Its IUPAC name is ethyl N-[2-[2-[2-methoxy-5-(trifluoromethyl)anilino]-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[2-[2-[2-methoxy-5-(trifluoromethyl)anilino]-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112523331 |
| Molecular Formula | C15H16F3N5O4 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | ethyl N-[2-[2-[2-methoxy-5-(trifluoromethyl)anilino]-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cnn(CC(=O)Nc2cc(C(F)(F)F)ccc2OC)n1 |
| InChI | InChI=1S/C15H16F3N5O4/c1-3-27-14(25)21-12-7-19-23(22-12)8-13(24)20-10-6-9(15(16,17)18)4-5-11(10)26-2/h4-7H,3,8H2,1-2H3,(H,20,24)(H,21,22,25) |
| InChIKey | QPRCBJNYUXFVFK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |