C15H16N6O3 — CID 112526366
ethyl N-[2-[2-(1H-indol-4-ylamino)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112526366) has the molecular formula C15H16N6O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is ethyl N-[2-[2-(1H-indol-4-ylamino)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[2-[2-(1H-indol-4-ylamino)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112526366 |
| Molecular Formula | C15H16N6O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | ethyl N-[2-[2-(1H-indol-4-ylamino)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cnn(CC(=O)Nc2cccc3[nH]ccc23)n1 |
| InChI | InChI=1S/C15H16N6O3/c1-2-24-15(23)19-13-8-17-21(20-13)9-14(22)18-12-5-3-4-11-10(12)6-7-16-11/h3-8,16H,2,9H2,1H3,(H,18,22)(H,19,20,23) |
| InChIKey | JWVTYRDYVIFXGW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |