C13H14ClN5O3 — CID 112520625
methyl N-[2-[2-(3-chloro-2-methylanilino)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112520625) has the molecular formula C13H14ClN5O3 and a molecular weight of 323.74 g/mol. Its IUPAC name is methyl N-[2-[2-(3-chloro-2-methylanilino)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | methyl N-[2-[2-(3-chloro-2-methylanilino)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112520625 |
| Molecular Formula | C13H14ClN5O3 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | methyl N-[2-[2-(3-chloro-2-methylanilino)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | COC(=O)Nc1cnn(CC(=O)Nc2cccc(Cl)c2C)n1 |
| InChI | InChI=1S/C13H14ClN5O3/c1-8-9(14)4-3-5-10(8)16-12(20)7-19-15-6-11(18-19)17-13(21)22-2/h3-6H,7H2,1-2H3,(H,16,20)(H,17,18,21) |
| InChIKey | JUSKNJYZAWCDOZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |