C10H13N7O3 — CID 112524871
methyl N-[2-[2-[(2-methylpyrazol-3-yl)amino]-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112524871) has the molecular formula C10H13N7O3 and a molecular weight of 279.26 g/mol. Its IUPAC name is methyl N-[2-[2-[(2-methylpyrazol-3-yl)amino]-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | methyl N-[2-[2-[(2-methylpyrazol-3-yl)amino]-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112524871 |
| Molecular Formula | C10H13N7O3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | methyl N-[2-[2-[(2-methylpyrazol-3-yl)amino]-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | COC(=O)Nc1cnn(CC(=O)Nc2ccnn2C)n1 |
| InChI | InChI=1S/C10H13N7O3/c1-16-8(3-4-11-16)14-9(18)6-17-12-5-7(15-17)13-10(19)20-2/h3-5H,6H2,1-2H3,(H,14,18)(H,13,15,19) |
| InChIKey | OESLIRZLUUYKDI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |