C13H16N6O3 — CID 112530230
methyl N-[2-[2-oxo-2-(2-pyridin-4-ylethylamino)ethyl]triazol-4-yl]carbamate (PubChem CID 112530230) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is methyl N-[2-[2-oxo-2-(2-pyridin-4-ylethylamino)ethyl]triazol-4-yl]carbamate.
| Compound Name | methyl N-[2-[2-oxo-2-(2-pyridin-4-ylethylamino)ethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112530230 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | methyl N-[2-[2-oxo-2-(2-pyridin-4-ylethylamino)ethyl]triazol-4-yl]carbamate |
| SMILES | COC(=O)Nc1cnn(CC(=O)NCCc2ccncc2)n1 |
| InChI | InChI=1S/C13H16N6O3/c1-22-13(21)17-11-8-16-19(18-11)9-12(20)15-7-4-10-2-5-14-6-3-10/h2-3,5-6,8H,4,7,9H2,1H3,(H,15,20)(H,17,18,21) |
| InChIKey | FFYVLAGFIGOUGR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |