C10H11N7O3 — CID 112524310
methyl N-[2-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]triazol-4-yl]carbamate (PubChem CID 112524310) has the molecular formula C10H11N7O3 and a molecular weight of 277.24 g/mol. Its IUPAC name is methyl N-[2-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]triazol-4-yl]carbamate.
| Compound Name | methyl N-[2-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112524310 |
| Molecular Formula | C10H11N7O3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | methyl N-[2-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]triazol-4-yl]carbamate |
| SMILES | COC(=O)Nc1cnn(CC(=O)Nc2ccncn2)n1 |
| InChI | InChI=1S/C10H11N7O3/c1-20-10(19)15-8-4-13-17(16-8)5-9(18)14-7-2-3-11-6-12-7/h2-4,6H,5H2,1H3,(H,15,16,19)(H,11,12,14,18) |
| InChIKey | UBBICMGUFVIIAA-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |