C13H13N7O3 — CID 112527416
methyl N-[2-[2-(3H-benzimidazol-5-ylamino)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112527416) has the molecular formula C13H13N7O3 and a molecular weight of 315.29 g/mol. Its IUPAC name is methyl N-[2-[2-(3H-benzimidazol-5-ylamino)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | methyl N-[2-[2-(3H-benzimidazol-5-ylamino)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112527416 |
| Molecular Formula | C13H13N7O3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl N-[2-[2-(3H-benzimidazol-5-ylamino)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | COC(=O)Nc1cnn(CC(=O)Nc2ccc3nc[nH]c3c2)n1 |
| InChI | InChI=1S/C13H13N7O3/c1-23-13(22)18-11-5-16-20(19-11)6-12(21)17-8-2-3-9-10(4-8)15-7-14-9/h2-5,7H,6H2,1H3,(H,14,15)(H,17,21)(H,18,19,22) |
| InChIKey | RTNAFKLHZYEXIE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |