C13H15N3O3 — CID 115174752
methyl 3-(3H-benzimidazol-5-ylamino)-2,2-dimethyl-3-oxopropanoate (PubChem CID 115174752) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is methyl 3-(3H-benzimidazol-5-ylamino)-2,2-dimethyl-3-oxopropanoate.
| Compound Name | methyl 3-(3H-benzimidazol-5-ylamino)-2,2-dimethyl-3-oxopropanoate |
|---|---|
| PubChem CID | 115174752 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | methyl 3-(3H-benzimidazol-5-ylamino)-2,2-dimethyl-3-oxopropanoate |
| SMILES | COC(=O)C(C)(C)C(=O)Nc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C13H15N3O3/c1-13(2,12(18)19-3)11(17)16-8-4-5-9-10(6-8)15-7-14-9/h4-7H,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | XPZGKCFMHWAFFA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|