C13H18N4O — CID 110748284
1-(3H-benzimidazol-5-yl)-3-(2,2-dimethylpropyl)urea (PubChem CID 110748284) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-3-(2,2-dimethylpropyl)urea.
| Compound Name | 1-(3H-benzimidazol-5-yl)-3-(2,2-dimethylpropyl)urea |
|---|---|
| PubChem CID | 110748284 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-3-(2,2-dimethylpropyl)urea |
| SMILES | CC(C)(C)CNC(=O)Nc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C13H18N4O/c1-13(2,3)7-14-12(18)17-9-4-5-10-11(6-9)16-8-15-10/h4-6,8H,7H2,1-3H3,(H,15,16)(H2,14,17,18) |
| InChIKey | UPJYMVZOVIDFHT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |