C17H18N4O3 — CID 25056225
1-(3H-benzimidazol-5-yl)-3-[(3,4-dimethoxyphenyl)methyl]urea (PubChem CID 25056225) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-3-[(3,4-dimethoxyphenyl)methyl]urea.
| Compound Name | 1-(3H-benzimidazol-5-yl)-3-[(3,4-dimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 25056225 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-3-[(3,4-dimethoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2ccc3nc[nH]c3c2)cc1OC |
| InChI | InChI=1S/C17H18N4O3/c1-23-15-6-3-11(7-16(15)24-2)9-18-17(22)21-12-4-5-13-14(8-12)20-10-19-13/h3-8,10H,9H2,1-2H3,(H,19,20)(H2,18,21,22) |
| InChIKey | BZEJGWYFKLLLCW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |