C16H24N4O — CID 108885927
1-(3H-benzimidazol-5-yl)-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 108885927) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-3-(2,4,4-trimethylpentan-2-yl)urea.
| Compound Name | 1-(3H-benzimidazol-5-yl)-3-(2,4,4-trimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 108885927 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)Nc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C16H24N4O/c1-15(2,3)9-16(4,5)20-14(21)19-11-6-7-12-13(8-11)18-10-17-12/h6-8,10H,9H2,1-5H3,(H,17,18)(H2,19,20,21) |
| InChIKey | GJWLCWUGNMEPHY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |