C16H16N4O — CID 108886016
1-(3H-benzimidazol-5-yl)-3-(2,6-dimethylphenyl)urea (PubChem CID 108886016) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-(3H-benzimidazol-5-yl)-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 108886016 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)Nc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C16H16N4O/c1-10-4-3-5-11(2)15(10)20-16(21)19-12-6-7-13-14(8-12)18-9-17-13/h3-9H,1-2H3,(H,17,18)(H2,19,20,21) |
| InChIKey | GEOKKEWGSLJHIT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |