C10H15N5O4 — CID 112530564
methyl N-[2-(2-morpholin-4-yl-2-oxoethyl)triazol-4-yl]carbamate (PubChem CID 112530564) has the molecular formula C10H15N5O4 and a molecular weight of 269.26 g/mol. Its IUPAC name is methyl N-[2-(2-morpholin-4-yl-2-oxoethyl)triazol-4-yl]carbamate.
| Compound Name | methyl N-[2-(2-morpholin-4-yl-2-oxoethyl)triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112530564 |
| Molecular Formula | C10H15N5O4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | methyl N-[2-(2-morpholin-4-yl-2-oxoethyl)triazol-4-yl]carbamate |
| SMILES | COC(=O)Nc1cnn(CC(=O)N2CCOCC2)n1 |
| InChI | InChI=1S/C10H15N5O4/c1-18-10(17)12-8-6-11-15(13-8)7-9(16)14-2-4-19-5-3-14/h6H,2-5,7H2,1H3,(H,12,13,17) |
| InChIKey | XMKXQVQMGKIGON-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |